C27H54N2O6 — CID 173281378
(1-heptoxy-1-oxohexan-2-yl)carbamic acid;heptyl 2-aminohexanoate (PubChem CID 173281378) has the molecular formula C27H54N2O6 and a molecular weight of 502.74 g/mol. Its IUPAC name is (1-heptoxy-1-oxohexan-2-yl)carbamic acid;heptyl 2-aminohexanoate.
| Compound Name | (1-heptoxy-1-oxohexan-2-yl)carbamic acid;heptyl 2-aminohexanoate |
|---|---|
| PubChem CID | 173281378 |
| Molecular Formula | C27H54N2O6 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | (1-heptoxy-1-oxohexan-2-yl)carbamic acid;heptyl 2-aminohexanoate |
| SMILES | CCCCCCCOC(=O)C(CCCC)NC(=O)O.CCCCCCCOC(=O)C(N)CCCC |
| InChI | InChI=1S/C14H27NO4.C13H27NO2/c1-3-5-7-8-9-11-19-13(16)12(10-6-4-2)15-14(17)18;1-3-5-7-8-9-11-16-13(15)12(14)10-6-4-2/h12,15H,3-11H2,1-2H3,(H,17,18);12H,3-11,14H2,1-2H3 |
| InChIKey | VUNYPZIJLCFYCP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|