About CID 173281821
CID 173281821 (PubChem CID 173281821) has the molecular formula C14H19B
and a molecular weight of 198.12 g/mol.
Molecular Properties
| Compound Name | CID 173281821 |
| PubChem CID | 173281821 |
| Molecular Formula | C14H19B |
| Molecular Weight | 198.12 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccccc1/C=C\CCCCCC |
| InChI | InChI=1S/C14H19B/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h7-12H,2-6H2,1H3/b10-7- |
| InChIKey | HFTBWFCWQAGMLM-YFHOEESVSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173281821 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173281821?
The IUPAC name of CID 173281821 (CID 173281821) is not available.
What is the SMILES notation for CID 173281821?
The canonical SMILES for CID 173281821 is [B]c1ccccc1/C=C\CCCCCC.
What is the InChIKey of CID 173281821?
The InChIKey is HFTBWFCWQAGMLM-YFHOEESVSA-N. The full InChI is InChI=1S/C14H19B/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h7-12H,2-6H2,1H3/b10-7-.
What are the key properties of CID 173281821?
CID 173281821 has a molecular weight of 198.12 g/mol, XLogP of 3.46, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173281821 is sourced from PubChem (CID 173281821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).