C4H4Cl4O — CID 173282499
2,3,4,4-tetrachlorobutanal (PubChem CID 173282499) has the molecular formula C4H4Cl4O and a molecular weight of 209.89 g/mol. Its IUPAC name is 2,3,4,4-tetrachlorobutanal.
| Compound Name | 2,3,4,4-tetrachlorobutanal |
|---|---|
| PubChem CID | 173282499 |
| Molecular Formula | C4H4Cl4O |
| Molecular Weight | 209.89 g/mol |
| Exact Mass | 207.90 |
| IUPAC Name | 2,3,4,4-tetrachlorobutanal |
| SMILES | O=CC(Cl)C(Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H4Cl4O/c5-2(1-9)3(6)4(7)8/h1-4H |
| InChIKey | LBOIDLNTJHODOL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|