C20H19ClN2O — CID 173284837
(4-chlorophenyl)-(1-indol-1-ylpiperidin-4-yl)methanone (PubChem CID 173284837) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is (4-chlorophenyl)-(1-indol-1-ylpiperidin-4-yl)methanone.
| Compound Name | (4-chlorophenyl)-(1-indol-1-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 173284837 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (4-chlorophenyl)-(1-indol-1-ylpiperidin-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)C1CCN(n2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C20H19ClN2O/c21-18-7-5-16(6-8-18)20(24)17-9-12-22(13-10-17)23-14-11-15-3-1-2-4-19(15)23/h1-8,11,14,17H,9-10,12-13H2 |
| InChIKey | CYMVGZNOVOIYEB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |