About 1-pyrrolidin-1-ylindole
1-pyrrolidin-1-ylindole (PubChem CID 19365073) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-pyrrolidin-1-ylindole.
Molecular Properties
| Compound Name | 1-pyrrolidin-1-ylindole |
| PubChem CID | 19365073 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-pyrrolidin-1-ylindole |
| SMILES | c1ccc2c(c1)ccn2N1CCCC1 |
| InChI | InChI=1S/C12H14N2/c1-2-6-12-11(5-1)7-10-14(12)13-8-3-4-9-13/h1-2,5-7,10H,3-4,8-9H2 |
| InChIKey | IQTHVFBDXFXODR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-pyrrolidin-1-ylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-1-ylindole?
The IUPAC name of 1-pyrrolidin-1-ylindole (CID 19365073) is 1-pyrrolidin-1-ylindole.
What is the SMILES notation for 1-pyrrolidin-1-ylindole?
The canonical SMILES for 1-pyrrolidin-1-ylindole is c1ccc2c(c1)ccn2N1CCCC1.
What is the InChIKey of 1-pyrrolidin-1-ylindole?
The InChIKey is IQTHVFBDXFXODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-6-12-11(5-1)7-10-14(12)13-8-3-4-9-13/h1-2,5-7,10H,3-4,8-9H2.
What are the key properties of 1-pyrrolidin-1-ylindole?
1-pyrrolidin-1-ylindole has a molecular weight of 186.26 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-1-ylindole is sourced from PubChem (CID 19365073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).