C19H15AsF26 — CID 173291179
5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)arsane (PubChem CID 173291179) has the molecular formula C19H15AsF26 and a molecular weight of 812.20 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)arsane.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)arsane |
|---|---|
| PubChem CID | 173291179 |
| Molecular Formula | C19H15AsF26 |
| Molecular Weight | 812.20 g/mol |
| Exact Mass | 812.00 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)arsane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC[AsH]CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15AsF26/c21-8(22,4-1-2-6-20-7-3-5-9(23,24)11(27,28)16(37,38)18(41,42)43)10(25,26)12(29,30)13(31,32)14(33,34)15(35,36)17(39,40)19(44,45)46/h20H,1-7H2 |
| InChIKey | CNAJVDBXDXWWIK-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.20 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|