About tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride
tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride (PubChem CID 173294793) has the molecular formula C22H31Cl3N2O2
and a molecular weight of 461.86 g/mol. Its IUPAC name is tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride.
Molecular Properties
| Compound Name | tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride |
| PubChem CID | 173294793 |
| Molecular Formula | C22H31Cl3N2O2 |
| Molecular Weight | 461.86 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride |
| SMILES | CC(C)(C)NN.Cc1cccc(C(=O)Cl)c1C(=O)c1ccc(C(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C18H17ClO2.C4H12N2.2ClH/c1-11(2)13-7-9-14(10-8-13)17(20)16-12(3)5-4-6-15(16)18(19)21;1-4(2,3)6-5;;/h4-11H,1-3H3;6H,5H2,1-3H3;2*1H |
| InChIKey | MLARYUOLNRPSGM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride?
The IUPAC name of tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride (CID 173294793) is tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride.
What is the SMILES notation for tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride?
The canonical SMILES for tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride is CC(C)(C)NN.Cc1cccc(C(=O)Cl)c1C(=O)c1ccc(C(C)C)cc1.Cl.Cl.
What is the InChIKey of tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride?
The InChIKey is MLARYUOLNRPSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClO2.C4H12N2.2ClH/c1-11(2)13-7-9-14(10-8-13)17(20)16-12(3)5-4-6-15(16)18(19)21;1-4(2,3)6-5;;/h4-11H,1-3H3;6H,5H2,1-3H3;2*1H.
What are the key properties of tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride?
tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride has a molecular weight of 461.86 g/mol, XLogP of 5.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylhydrazine;3-methyl-2-(4-propan-2-ylbenzoyl)benzoyl chloride;dihydrochloride is sourced from PubChem (CID 173294793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).