About tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride
tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride (PubChem CID 173294654) has the molecular formula C19H24Cl3FN2O2
and a molecular weight of 437.77 g/mol. Its IUPAC name is tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride.
Molecular Properties
| Compound Name | tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride |
| PubChem CID | 173294654 |
| Molecular Formula | C19H24Cl3FN2O2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride |
| SMILES | CC(C)(C)NN.Cc1cccc(C(=O)Cl)c1C(=O)c1ccccc1F.Cl.Cl |
| InChI | InChI=1S/C15H10ClFO2.C4H12N2.2ClH/c1-9-5-4-7-11(15(16)19)13(9)14(18)10-6-2-3-8-12(10)17;1-4(2,3)6-5;;/h2-8H,1H3;6H,5H2,1-3H3;2*1H |
| InChIKey | ZYMNIMNSYZCCKA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride?
The IUPAC name of tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride (CID 173294654) is tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride.
What is the SMILES notation for tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride?
The canonical SMILES for tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride is CC(C)(C)NN.Cc1cccc(C(=O)Cl)c1C(=O)c1ccccc1F.Cl.Cl.
What is the InChIKey of tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride?
The InChIKey is ZYMNIMNSYZCCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClFO2.C4H12N2.2ClH/c1-9-5-4-7-11(15(16)19)13(9)14(18)10-6-2-3-8-12(10)17;1-4(2,3)6-5;;/h2-8H,1H3;6H,5H2,1-3H3;2*1H.
What are the key properties of tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride?
tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride has a molecular weight of 437.77 g/mol, XLogP of 4.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylhydrazine;2-(2-fluorobenzoyl)-3-methylbenzoyl chloride;dihydrochloride is sourced from PubChem (CID 173294654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).