C11H18N4O6 — CID 173297225
methyl 2,5-diamino-3-nitro-5-oxo-4-(2-propoxyethylimino)pent-2-enoate (PubChem CID 173297225) has the molecular formula C11H18N4O6 and a molecular weight of 302.29 g/mol. Its IUPAC name is methyl 2,5-diamino-3-nitro-5-oxo-4-(2-propoxyethylimino)pent-2-enoate.
| Compound Name | methyl 2,5-diamino-3-nitro-5-oxo-4-(2-propoxyethylimino)pent-2-enoate |
|---|---|
| PubChem CID | 173297225 |
| Molecular Formula | C11H18N4O6 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl 2,5-diamino-3-nitro-5-oxo-4-(2-propoxyethylimino)pent-2-enoate |
| SMILES | CCCOCC/N=C(\C(N)=O)C(=C(N)C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C11H18N4O6/c1-3-5-21-6-4-14-8(10(13)16)9(15(18)19)7(12)11(17)20-2/h3-6,12H2,1-2H3,(H2,13,16)/b9-7?,14-8- |
| InChIKey | KJVHSLBJAQNSPC-JIXAHBDMSA-N |
| XLogP | -1.04 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|