C27H33N — CID 173298083
(3S)-1,6-diphenyl-4-(3-propan-2-ylphenyl)hexan-3-amine (PubChem CID 173298083) has the molecular formula C27H33N and a molecular weight of 371.57 g/mol. Its IUPAC name is (3S)-1,6-diphenyl-4-(3-propan-2-ylphenyl)hexan-3-amine.
| Compound Name | (3S)-1,6-diphenyl-4-(3-propan-2-ylphenyl)hexan-3-amine |
|---|---|
| PubChem CID | 173298083 |
| Molecular Formula | C27H33N |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (3S)-1,6-diphenyl-4-(3-propan-2-ylphenyl)hexan-3-amine |
| SMILES | CC(C)c1cccc(C(CCc2ccccc2)[C@@H](N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C27H33N/c1-21(2)24-14-9-15-25(20-24)26(18-16-22-10-5-3-6-11-22)27(28)19-17-23-12-7-4-8-13-23/h3-15,20-21,26-27H,16-19,28H2,1-2H3/t26?,27-/m0/s1 |
| InChIKey | KCGRFXRZHSCXQI-GEVKEYJPSA-N |
| XLogP | 6.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |