C17H26Cs2O5S — CID 173298779
dicesium;2-(2-nonylphenyl)oxirane;sulfate (PubChem CID 173298779) has the molecular formula C17H26Cs2O5S and a molecular weight of 608.27 g/mol. Its IUPAC name is dicesium;2-(2-nonylphenyl)oxirane;sulfate.
| Compound Name | dicesium;2-(2-nonylphenyl)oxirane;sulfate |
|---|---|
| PubChem CID | 173298779 |
| Molecular Formula | C17H26Cs2O5S |
| Molecular Weight | 608.27 g/mol |
| Exact Mass | 607.96 |
| IUPAC Name | dicesium;2-(2-nonylphenyl)oxirane;sulfate |
| SMILES | CCCCCCCCCc1ccccc1C1CO1.O=S(=O)([O-])[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/C17H26O.2Cs.H2O4S/c1-2-3-4-5-6-7-8-11-15-12-9-10-13-16(15)17-14-18-17;;;1-5(2,3)4/h9-10,12-13,17H,2-8,11,14H2,1H3;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | IHKBDRKWCMMFJE-UHFFFAOYSA-L |
| XLogP | -2.28 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.27 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|