C34H62CuN10O5S2 — CID 173300807
2-aminoethyl(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-ylsulfonyl)sulfamic acid;copper (PubChem CID 173300807) has the molecular formula C34H62CuN10O5S2 and a molecular weight of 818.61 g/mol. Its IUPAC name is 2-aminoethyl(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-ylsulfonyl)sulfamic acid;copper.
| Compound Name | 2-aminoethyl(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-ylsulfonyl)sulfamic acid;copper |
|---|---|
| PubChem CID | 173300807 |
| Molecular Formula | C34H62CuN10O5S2 |
| Molecular Weight | 818.61 g/mol |
| Exact Mass | 817.36 |
| IUPAC Name | 2-aminoethyl(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-ylsulfonyl)sulfamic acid;copper |
| SMILES | NCCN(S(=O)(=O)O)S(=O)(=O)C1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C21)C1CCCCC61)C1CCCCC51)C1CCCCC41.[Cu] |
| InChI | InChI=1S/C34H62N10O5S2.Cu/c35-16-17-44(51(47,48)49)50(45,46)25-15-7-14-24-26(25)34-42-32-23-13-6-5-12-22(23)30(40-32)38-28-19-9-2-1-8-18(19)27(36-28)37-29-20-10-3-4-11-21(20)31(39-29)41-33(24)43-34;/h18-34,36-43H,1-17,35H2,(H,47,48,49); |
| InChIKey | UIYFATQLVCWAAR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 214.01 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.61 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|