C32H54Cl2CoN8O8S2 — CID 173301821
cobalt;32,33-dichloro-34,35-dihydroxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6-disulfonic acid (PubChem CID 173301821) has the molecular formula C32H54Cl2CoN8O8S2 and a molecular weight of 872.80 g/mol. Its IUPAC name is cobalt;32,33-dichloro-34,35-dihydroxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6-disulfonic acid.
| Compound Name | cobalt;32,33-dichloro-34,35-dihydroxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6-disulfonic acid |
|---|---|
| PubChem CID | 173301821 |
| Molecular Formula | C32H54Cl2CoN8O8S2 |
| Molecular Weight | 872.80 g/mol |
| Exact Mass | 871.22 |
| IUPAC Name | cobalt;32,33-dichloro-34,35-dihydroxy-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6-disulfonic acid |
| SMILES | O=S(=O)(O)C1CCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C1S(=O)(=O)O)C1C(O)C(O)C(Cl)C(Cl)C61)C1CCCCC51)C1CCCCC41.[Co] |
| InChI | InChI=1S/C32H54Cl2N8O8S2.Co/c33-20-18-19(22(43)23(44)21(20)34)32-41-30-17-15(9-10-16(51(45,46)47)24(17)52(48,49)50)29(40-30)38-27-12-6-2-1-5-11(12)25(36-27)35-26-13-7-3-4-8-14(13)28(37-26)39-31(18)42-32;/h11-32,35-44H,1-10H2,(H,45,46,47)(H,48,49,50); |
| InChIKey | MDEQGPOTGFRVSE-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 245.44 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.80 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|