C32H54Cl2N8O2 — CID 173320181
6,7-dichloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,8-diol (PubChem CID 173320181) has the molecular formula C32H54Cl2N8O2 and a molecular weight of 653.74 g/mol. Its IUPAC name is 6,7-dichloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,8-diol.
| Compound Name | 6,7-dichloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,8-diol |
|---|---|
| PubChem CID | 173320181 |
| Molecular Formula | C32H54Cl2N8O2 |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | 6,7-dichloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,8-diol |
| SMILES | OC1C(Cl)C(Cl)C(O)C2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C32H54Cl2N8O2/c33-21-22(34)24(44)20-19(23(21)43)31-40-29-17-11-5-3-9-15(17)27(38-29)36-25-13-7-1-2-8-14(13)26(35-25)37-28-16-10-4-6-12-18(16)30(39-28)41-32(20)42-31/h13-32,35-44H,1-12H2 |
| InChIKey | XXVDJDZDXPQJDQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|