C32H58Cl2GeN8 — CID 173206872
dichlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 173206872) has the molecular formula C32H58Cl2GeN8 and a molecular weight of 698.39 g/mol. Its IUPAC name is dichlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | dichlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 173206872 |
| Molecular Formula | C32H58Cl2GeN8 |
| Molecular Weight | 698.39 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | dichlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C2C1.Cl[GeH2]Cl |
| InChI | InChI=1S/C32H56N8.Cl2GeH2/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-3-2/h17-40H,1-16H2;3H2 |
| InChIKey | BBZRKSGVJHNQFX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |