C32H56GaI3N8 — CID 174419449
2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;triiodogallane (PubChem CID 174419449) has the molecular formula C32H56GaI3N8 and a molecular weight of 1003.29 g/mol. Its IUPAC name is 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;triiodogallane.
| Compound Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;triiodogallane |
|---|---|
| PubChem CID | 174419449 |
| Molecular Formula | C32H56GaI3N8 |
| Molecular Weight | 1003.29 g/mol |
| Exact Mass | 1002.10 |
| IUPAC Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;triiodogallane |
| SMILES | C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C2C1.I[Ga](I)I |
| InChI | InChI=1S/C32H56N8.Ga.3HI/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;;;;/h17-40H,1-16H2;;3*1H/q;+3;;;/p-3 |
| InChIKey | FWBFFSBYWZAFSB-UHFFFAOYSA-K |
| XLogP | 4.88 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|