C32H59ClGeN8 — CID 173095698
chlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 173095698) has the molecular formula C32H59ClGeN8 and a molecular weight of 663.94 g/mol. Its IUPAC name is chlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | chlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 173095698 |
| Molecular Formula | C32H59ClGeN8 |
| Molecular Weight | 663.94 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | chlorogermane;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C2C1.Cl[GeH3] |
| InChI | InChI=1S/C32H56N8.ClGeH3/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-2/h17-40H,1-16H2;2H3 |
| InChIKey | HLEJSXPVWHQNKC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.94 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |