C19H41BrClN — CID 173305145
1-chloro-N,N-dimethylheptadecan-6-amine;hydrobromide (PubChem CID 173305145) has the molecular formula C19H41BrClN and a molecular weight of 398.90 g/mol. Its IUPAC name is 1-chloro-N,N-dimethylheptadecan-6-amine;hydrobromide.
| Compound Name | 1-chloro-N,N-dimethylheptadecan-6-amine;hydrobromide |
|---|---|
| PubChem CID | 173305145 |
| Molecular Formula | C19H41BrClN |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-chloro-N,N-dimethylheptadecan-6-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCC(CCCCCCl)N(C)C |
| InChI | InChI=1S/C19H40ClN.BrH/c1-4-5-6-7-8-9-10-11-13-16-19(21(2)3)17-14-12-15-18-20;/h19H,4-18H2,1-3H3;1H |
| InChIKey | FJGDTPAICWZDPK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|