About 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide
16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide (PubChem CID 175431925) has the molecular formula C18H39Br2N
and a molecular weight of 429.33 g/mol. Its IUPAC name is 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide.
Molecular Properties
| Compound Name | 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide |
| PubChem CID | 175431925 |
| Molecular Formula | C18H39Br2N |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide |
| SMILES | Br.CCCCCCCC(CCCCCCCCBr)N(C)C |
| InChI | InChI=1S/C18H38BrN.BrH/c1-4-5-6-9-12-15-18(20(2)3)16-13-10-7-8-11-14-17-19;/h18H,4-17H2,1-3H3;1H |
| InChIKey | VBWDCSLGQBYWJT-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide?
The IUPAC name of 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide (CID 175431925) is 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide.
What is the SMILES notation for 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide?
The canonical SMILES for 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide is Br.CCCCCCCC(CCCCCCCCBr)N(C)C.
What is the InChIKey of 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide?
The InChIKey is VBWDCSLGQBYWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38BrN.BrH/c1-4-5-6-9-12-15-18(20(2)3)16-13-10-7-8-11-14-17-19;/h18H,4-17H2,1-3H3;1H.
What are the key properties of 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide?
16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide has a molecular weight of 429.33 g/mol, XLogP of 6.98, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 16-bromo-N,N-dimethylhexadecan-8-amine;hydrobromide is sourced from PubChem (CID 175431925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).