C17H18N3O2+ — CID 173305762
amino-oxo-[4-[2-oxo-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)ethyl]phenyl]azanium (PubChem CID 173305762) has the molecular formula C17H18N3O2+ and a molecular weight of 296.35 g/mol. Its IUPAC name is amino-oxo-[4-[2-oxo-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)ethyl]phenyl]azanium.
| Compound Name | amino-oxo-[4-[2-oxo-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)ethyl]phenyl]azanium |
|---|---|
| PubChem CID | 173305762 |
| Molecular Formula | C17H18N3O2+ |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | amino-oxo-[4-[2-oxo-2-(1,2,3,4-tetrahydroisoquinolin-1-yl)ethyl]phenyl]azanium |
| SMILES | N[N+](=O)c1ccc(CC(=O)C2NCCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18N3O2/c18-20(22)14-7-5-12(6-8-14)11-16(21)17-15-4-2-1-3-13(15)9-10-19-17/h1-8,17,19H,9-11H2,(H2,18,22)/q+1 |
| InChIKey | NBLGMGGQHNQZRW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|