C22H44O7Si3 — CID 173306108
[4-(2-silyloxan-2-yl)-1-[2-(2-trimethoxysilylethylsilyl)oxan-2-yl]butan-2-yl] prop-2-enoate (PubChem CID 173306108) has the molecular formula C22H44O7Si3 and a molecular weight of 504.85 g/mol. Its IUPAC name is [4-(2-silyloxan-2-yl)-1-[2-(2-trimethoxysilylethylsilyl)oxan-2-yl]butan-2-yl] prop-2-enoate.
| Compound Name | [4-(2-silyloxan-2-yl)-1-[2-(2-trimethoxysilylethylsilyl)oxan-2-yl]butan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 173306108 |
| Molecular Formula | C22H44O7Si3 |
| Molecular Weight | 504.85 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | [4-(2-silyloxan-2-yl)-1-[2-(2-trimethoxysilylethylsilyl)oxan-2-yl]butan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CCC1([SiH3])CCCCO1)CC1([SiH2]CC[Si](OC)(OC)OC)CCCCO1 |
| InChI | InChI=1S/C22H44O7Si3/c1-5-20(23)29-19(10-13-21(30)11-6-8-14-27-21)18-22(12-7-9-15-28-22)31-16-17-32(24-2,25-3)26-4/h5,19H,1,6-18,31H2,2-4,30H3 |
| InChIKey | BDPDCZFZADWFQQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.85 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|