C19H40O5Si3 — CID 123745729
[1-[2-[ethenyl(methyl)silyl]oxan-2-yl]-3-(2-silyloxan-2-yl)propan-2-yl]-trimethoxysilane (PubChem CID 123745729) has the molecular formula C19H40O5Si3 and a molecular weight of 432.78 g/mol. Its IUPAC name is [1-[2-[ethenyl(methyl)silyl]oxan-2-yl]-3-(2-silyloxan-2-yl)propan-2-yl]-trimethoxysilane.
| Compound Name | [1-[2-[ethenyl(methyl)silyl]oxan-2-yl]-3-(2-silyloxan-2-yl)propan-2-yl]-trimethoxysilane |
|---|---|
| PubChem CID | 123745729 |
| Molecular Formula | C19H40O5Si3 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [1-[2-[ethenyl(methyl)silyl]oxan-2-yl]-3-(2-silyloxan-2-yl)propan-2-yl]-trimethoxysilane |
| SMILES | C=C[SiH](C)C1(CC(CC2([SiH3])CCCCO2)[Si](OC)(OC)OC)CCCCO1 |
| InChI | InChI=1S/C19H40O5Si3/c1-6-26(5)19(12-8-10-14-24-19)16-17(27(20-2,21-3)22-4)15-18(25)11-7-9-13-23-18/h6,17,26H,1,7-16H2,2-5,25H3 |
| InChIKey | WGJNBUHMWSAOOP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|