C23H27N5OS — CID 173309775
1-methyl-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carboximidoyl)piperidine-3-carboxamide (PubChem CID 173309775) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 1-methyl-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carboximidoyl)piperidine-3-carboxamide.
| Compound Name | 1-methyl-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carboximidoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 173309775 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-methyl-N-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazole-1-carboximidoyl)piperidine-3-carboxamide |
| SMILES | [H]/N=C(\NC(=O)C1CCCN(C)C1)c1c(-c2ccccc2)nc2sc3c(n12)CCCC3 |
| InChI | InChI=1S/C23H27N5OS/c1-27-13-7-10-16(14-27)22(29)26-21(24)20-19(15-8-3-2-4-9-15)25-23-28(20)17-11-5-6-12-18(17)30-23/h2-4,8-9,16H,5-7,10-14H2,1H3,(H2,24,26,29) |
| InChIKey | RPJZRCWILWLBDZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|