C29H31N5OS — CID 15858796
1-benzyl-N-[(E)-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]piperidine-3-carboxamide (PubChem CID 15858796) has the molecular formula C29H31N5OS and a molecular weight of 497.67 g/mol. Its IUPAC name is 1-benzyl-N-[(E)-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[(E)-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 15858796 |
| Molecular Formula | C29H31N5OS |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 1-benzyl-N-[(E)-(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]piperidine-3-carboxamide |
| SMILES | O=C(N/N=C/c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C29H31N5OS/c35-28(23-14-9-17-33(20-23)19-21-10-3-1-4-11-21)32-30-18-25-27(22-12-5-2-6-13-22)31-29-34(25)24-15-7-8-16-26(24)36-29/h1-6,10-13,18,23H,7-9,14-17,19-20H2,(H,32,35)/b30-18+ |
| InChIKey | YLBNSPWVKYZEQU-UXHLAJHPSA-N |
| XLogP | 5.30 |
| TPSA | 62.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|