C20H32N2O2 — CID 173312654
N-(1-aminoprop-1-enyl)-3,5-ditert-butyl-4-methoxy-2-methylbenzamide (PubChem CID 173312654) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(1-aminoprop-1-enyl)-3,5-ditert-butyl-4-methoxy-2-methylbenzamide.
| Compound Name | N-(1-aminoprop-1-enyl)-3,5-ditert-butyl-4-methoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 173312654 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | N-(1-aminoprop-1-enyl)-3,5-ditert-butyl-4-methoxy-2-methylbenzamide |
| SMILES | CC=C(N)NC(=O)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1C |
| InChI | InChI=1S/C20H32N2O2/c1-10-15(21)22-18(23)13-11-14(19(3,4)5)17(24-9)16(12(13)2)20(6,7)8/h10-11H,21H2,1-9H3,(H,22,23) |
| InChIKey | PQVKVXSCDYYFQR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |