About CID 173312764
CID 173312764 (PubChem CID 173312764) has the molecular formula C2H7BKN
and a molecular weight of 94.99 g/mol.
Molecular Properties
| Compound Name | CID 173312764 |
| PubChem CID | 173312764 |
| Molecular Formula | C2H7BKN |
| Molecular Weight | 94.99 g/mol |
| Exact Mass | 95.03 |
| IUPAC Name | — |
| SMILES | [B]N(C)C.[H-].[K+] |
| InChI | InChI=1S/C2H6BN.K.H/c1-4(2)3;;/h1-2H3;;/q;+1;-1 |
| InChIKey | SFQLRJQQAHUXOF-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.99 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173312764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173312764?
The IUPAC name of CID 173312764 (CID 173312764) is not available.
What is the SMILES notation for CID 173312764?
The canonical SMILES for CID 173312764 is [B]N(C)C.[H-].[K+].
What is the InChIKey of CID 173312764?
The InChIKey is SFQLRJQQAHUXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6BN.K.H/c1-4(2)3;;/h1-2H3;;/q;+1;-1.
What are the key properties of CID 173312764?
CID 173312764 has a molecular weight of 94.99 g/mol, XLogP of -3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173312764 is sourced from PubChem (CID 173312764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).