potassium N-methanidyl-N-methylmethanamine

C3H8KN — CID 58636134

IUPACpotassium N-methanidyl-N-methylmethanamine
SMILES[CH2-]N(C)C.[K+]
InChIInChI=1S/C3H8N.K/c1-4(2)3;/h1H2,2-3H3;/q-1;+1
InChIKeyHMPMERCZIKMZEW-UHFFFAOYSA-N
MW97.20 g/mol
LogP-2.66
Rot. Bonds

About potassium N-methanidyl-N-methylmethanamine

potassium N-methanidyl-N-methylmethanamine (PubChem CID 58636134) has the molecular formula C3H8KN and a molecular weight of 97.20 g/mol. Its IUPAC name is potassium N-methanidyl-N-methylmethanamine.

Molecular Properties

Compound Namepotassium N-methanidyl-N-methylmethanamine
PubChem CID58636134
Molecular FormulaC3H8KN
Molecular Weight97.20 g/mol
Exact Mass97.03
IUPAC Namepotassium N-methanidyl-N-methylmethanamine
SMILES[CH2-]N(C)C.[K+]
InChIInChI=1S/C3H8N.K/c1-4(2)3;/h1H2,2-3H3;/q-1;+1
InChIKeyHMPMERCZIKMZEW-UHFFFAOYSA-N
XLogP-2.66
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms5
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50097.20
LogP ≤ 5-2.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze potassium N-methanidyl-N-methylmethanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium N-methanidyl-N-methylmethanamine?
The IUPAC name of potassium N-methanidyl-N-methylmethanamine (CID 58636134) is potassium N-methanidyl-N-methylmethanamine.
What is the SMILES notation for potassium N-methanidyl-N-methylmethanamine?
The canonical SMILES for potassium N-methanidyl-N-methylmethanamine is [CH2-]N(C)C.[K+].
What is the InChIKey of potassium N-methanidyl-N-methylmethanamine?
The InChIKey is HMPMERCZIKMZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N.K/c1-4(2)3;/h1H2,2-3H3;/q-1;+1.
What are the key properties of potassium N-methanidyl-N-methylmethanamine?
potassium N-methanidyl-N-methylmethanamine has a molecular weight of 97.20 g/mol, XLogP of -2.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-methanidyl-N-methylmethanamine is sourced from PubChem (CID 58636134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).