C8H13HfN-2 — CID 174630903
cyclopenta-1,3-diene;hafnium;N-methanidyl-N-methylmethanamine (PubChem CID 174630903) has the molecular formula C8H13HfN-2 and a molecular weight of 301.69 g/mol. Its IUPAC name is cyclopenta-1,3-diene;hafnium;N-methanidyl-N-methylmethanamine.
| Compound Name | cyclopenta-1,3-diene;hafnium;N-methanidyl-N-methylmethanamine |
|---|---|
| PubChem CID | 174630903 |
| Molecular Formula | C8H13HfN-2 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | cyclopenta-1,3-diene;hafnium;N-methanidyl-N-methylmethanamine |
| SMILES | [C-]1=CC=CC1.[CH2-]N(C)C.[Hf] |
| InChI | InChI=1S/C5H5.C3H8N.Hf/c1-2-4-5-3-1;1-4(2)3;/h1-3H,4H2;1H2,2-3H3;/q2*-1; |
| InChIKey | STGYWKIVSKXEND-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|