C15H29FO3 — CID 173315719
(2R,3R,4S)-4-fluoro-3-pentoxy-2-(pentoxymethyl)oxolane (PubChem CID 173315719) has the molecular formula C15H29FO3 and a molecular weight of 276.39 g/mol. Its IUPAC name is (2R,3R,4S)-4-fluoro-3-pentoxy-2-(pentoxymethyl)oxolane.
| Compound Name | (2R,3R,4S)-4-fluoro-3-pentoxy-2-(pentoxymethyl)oxolane |
|---|---|
| PubChem CID | 173315719 |
| Molecular Formula | C15H29FO3 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (2R,3R,4S)-4-fluoro-3-pentoxy-2-(pentoxymethyl)oxolane |
| SMILES | CCCCCOC[C@H]1OC[C@H](F)[C@@H]1OCCCCC |
| InChI | InChI=1S/C15H29FO3/c1-3-5-7-9-17-12-14-15(13(16)11-19-14)18-10-8-6-4-2/h13-15H,3-12H2,1-2H3/t13-,14+,15-/m0/s1 |
| InChIKey | NFYZJFAOVVXZQQ-ZNMIVQPWSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|