C15H20N4O2 — CID 173317132
3,9-bis(cyclobutylmethyl)purine-2,6-dione (PubChem CID 173317132) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3,9-bis(cyclobutylmethyl)purine-2,6-dione.
| Compound Name | 3,9-bis(cyclobutylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 173317132 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3,9-bis(cyclobutylmethyl)purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(CC2CCC2)c2c1ncn2CC1CCC1 |
| InChI | InChI=1S/C15H20N4O2/c20-13-12-14(18(9-16-12)7-10-3-1-4-10)19(15(21)17-13)8-11-5-2-6-11/h9-11H,1-8H2,(H,17,20,21) |
| InChIKey | DUQCUGUEWMUZRZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |