About benzyl-chloro-dimethoxysilane;1-phenylethoxysilane
benzyl-chloro-dimethoxysilane;1-phenylethoxysilane (PubChem CID 173322617) has the molecular formula C17H25ClO3Si2
and a molecular weight of 369.01 g/mol. Its IUPAC name is benzyl-chloro-dimethoxysilane;1-phenylethoxysilane.
Molecular Properties
| Compound Name | benzyl-chloro-dimethoxysilane;1-phenylethoxysilane |
| PubChem CID | 173322617 |
| Molecular Formula | C17H25ClO3Si2 |
| Molecular Weight | 369.01 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | benzyl-chloro-dimethoxysilane;1-phenylethoxysilane |
| SMILES | CC(O[SiH3])c1ccccc1.CO[Si](Cl)(Cc1ccccc1)OC |
| InChI | InChI=1S/C9H13ClO2Si.C8H12OSi/c1-11-13(10,12-2)8-9-6-4-3-5-7-9;1-7(9-10)8-5-3-2-4-6-8/h3-7H,8H2,1-2H3;2-7H,1,10H3 |
| InChIKey | JFIMGZJAXGWQEO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.01 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze benzyl-chloro-dimethoxysilane;1-phenylethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-chloro-dimethoxysilane;1-phenylethoxysilane?
The IUPAC name of benzyl-chloro-dimethoxysilane;1-phenylethoxysilane (CID 173322617) is benzyl-chloro-dimethoxysilane;1-phenylethoxysilane.
What is the SMILES notation for benzyl-chloro-dimethoxysilane;1-phenylethoxysilane?
The canonical SMILES for benzyl-chloro-dimethoxysilane;1-phenylethoxysilane is CC(O[SiH3])c1ccccc1.CO[Si](Cl)(Cc1ccccc1)OC.
What is the InChIKey of benzyl-chloro-dimethoxysilane;1-phenylethoxysilane?
The InChIKey is JFIMGZJAXGWQEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClO2Si.C8H12OSi/c1-11-13(10,12-2)8-9-6-4-3-5-7-9;1-7(9-10)8-5-3-2-4-6-8/h3-7H,8H2,1-2H3;2-7H,1,10H3.
What are the key properties of benzyl-chloro-dimethoxysilane;1-phenylethoxysilane?
benzyl-chloro-dimethoxysilane;1-phenylethoxysilane has a molecular weight of 369.01 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-chloro-dimethoxysilane;1-phenylethoxysilane is sourced from PubChem (CID 173322617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).