C18H23N11O5S3 — CID 173322954
(6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(3,4,5,6-tetraamino-4H-pyrimidin-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 173322954) has the molecular formula C18H23N11O5S3 and a molecular weight of 569.66 g/mol. Its IUPAC name is (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(3,4,5,6-tetraamino-4H-pyrimidin-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(3,4,5,6-tetraamino-4H-pyrimidin-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 173322954 |
| Molecular Formula | C18H23N11O5S3 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | (6S)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(3,4,5,6-tetraamino-4H-pyrimidin-2-yl)sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(CSC3=NC(N)=C(N)C(N)N3N)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C18H23N11O5S3/c1-34-27-8(6-4-36-17(22)24-6)13(30)25-9-14(31)28-10(16(32)33)5(2-35-15(9)28)3-37-18-26-11(20)7(19)12(21)29(18)23/h4,9,12,15H,2-3,19-21,23H2,1H3,(H2,22,24)(H,25,30)(H,32,33)/b27-8-/t9?,12?,15-/m0/s1 |
| InChIKey | MLJMRLCFSDYNRI-GUGZTMLUSA-N |
| XLogP | -2.54 |
| TPSA | 266.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|