C41H79NO6S — CID 173323272
methyl hydrogen sulfate;(Z)-2-[[(Z)-1-oxoicos-11-en-2-yl]amino]icos-11-enal (PubChem CID 173323272) has the molecular formula C41H79NO6S and a molecular weight of 714.15 g/mol. Its IUPAC name is methyl hydrogen sulfate;(Z)-2-[[(Z)-1-oxoicos-11-en-2-yl]amino]icos-11-enal.
| Compound Name | methyl hydrogen sulfate;(Z)-2-[[(Z)-1-oxoicos-11-en-2-yl]amino]icos-11-enal |
|---|---|
| PubChem CID | 173323272 |
| Molecular Formula | C41H79NO6S |
| Molecular Weight | 714.15 g/mol |
| Exact Mass | 713.56 |
| IUPAC Name | methyl hydrogen sulfate;(Z)-2-[[(Z)-1-oxoicos-11-en-2-yl]amino]icos-11-enal |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(C=O)NC(C=O)CCCCCCCC/C=C\CCCCCCCC.COS(=O)(=O)O |
| InChI | InChI=1S/C40H75NO2.CH4O4S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39(37-42)41-40(38-43)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-5-6(2,3)4/h17-20,37-41H,3-16,21-36H2,1-2H3;1H3,(H,2,3,4)/b19-17-,20-18-; |
| InChIKey | LVLMLMZCRIDKLB-AWLASTDMSA-N |
| XLogP | 12.00 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.15 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|