C24H46N2O2 — CID 135254438
(Z)-N-(6-amino-1-oxohexan-2-yl)octadec-9-enamide (PubChem CID 135254438) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is (Z)-N-(6-amino-1-oxohexan-2-yl)octadec-9-enamide.
| Compound Name | (Z)-N-(6-amino-1-oxohexan-2-yl)octadec-9-enamide |
|---|---|
| PubChem CID | 135254438 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | (Z)-N-(6-amino-1-oxohexan-2-yl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(C=O)CCCCN |
| InChI | InChI=1S/C24H46N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-24(28)26-23(22-27)19-17-18-21-25/h9-10,22-23H,2-8,11-21,25H2,1H3,(H,26,28)/b10-9- |
| InChIKey | NAYDDNJKNPATFO-KTKRTIGZSA-N |
| XLogP | 5.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|