C18H34Sn — CID 173323579
(1,2,3-tributylcyclohex-2-en-1-yl)-λ2-stannane (PubChem CID 173323579) has the molecular formula C18H34Sn and a molecular weight of 369.18 g/mol. Its IUPAC name is (1,2,3-tributylcyclohex-2-en-1-yl)-λ2-stannane.
| Compound Name | (1,2,3-tributylcyclohex-2-en-1-yl)-λ2-stannane |
|---|---|
| PubChem CID | 173323579 |
| Molecular Formula | C18H34Sn |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (1,2,3-tributylcyclohex-2-en-1-yl)-λ2-stannane |
| SMILES | CCCCC1=C(CCCC)C([SnH])(CCCC)CCC1 |
| InChI | InChI=1S/C18H33.Sn.H/c1-4-7-11-16-13-10-14-17(12-8-5-2)18(16)15-9-6-3;;/h4-15H2,1-3H3;; |
| InChIKey | ZIFXYFUWNFPGPN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|