About 2,3-dichloropyrazine;pyrazine
2,3-dichloropyrazine;pyrazine (PubChem CID 173325977) has the molecular formula C28H26Cl2N14
and a molecular weight of 629.52 g/mol. Its IUPAC name is 2,3-dichloropyrazine;pyrazine.
Molecular Properties
| Compound Name | 2,3-dichloropyrazine;pyrazine |
| PubChem CID | 173325977 |
| Molecular Formula | C28H26Cl2N14 |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 2,3-dichloropyrazine;pyrazine |
| SMILES | Clc1nccnc1Cl.c1cnccn1.c1cnccn1.c1cnccn1.c1cnccn1.c1cnccn1.c1cnccn1 |
| InChI | InChI=1S/C4H2Cl2N2.6C4H4N2/c5-3-4(6)8-2-1-7-3;6*1-2-6-4-3-5-1/h1-2H;6*1-4H |
| InChIKey | DTYMJENENWSVAM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 180.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
Analyze 2,3-dichloropyrazine;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloropyrazine;pyrazine?
The IUPAC name of 2,3-dichloropyrazine;pyrazine (CID 173325977) is 2,3-dichloropyrazine;pyrazine.
What is the SMILES notation for 2,3-dichloropyrazine;pyrazine?
The canonical SMILES for 2,3-dichloropyrazine;pyrazine is Clc1nccnc1Cl.c1cnccn1.c1cnccn1.c1cnccn1.c1cnccn1.c1cnccn1.c1cnccn1.
What is the InChIKey of 2,3-dichloropyrazine;pyrazine?
The InChIKey is DTYMJENENWSVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Cl2N2.6C4H4N2/c5-3-4(6)8-2-1-7-3;6*1-2-6-4-3-5-1/h1-2H;6*1-4H.
What are the key properties of 2,3-dichloropyrazine;pyrazine?
2,3-dichloropyrazine;pyrazine has a molecular weight of 629.52 g/mol, XLogP of 4.64, 0 rotatable bonds, 0 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloropyrazine;pyrazine is sourced from PubChem (CID 173325977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).