C11H16O2 — CID 173326512
3,4-dimethyl-2-prop-2-ynylhex-3-enoic acid (PubChem CID 173326512) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,4-dimethyl-2-prop-2-ynylhex-3-enoic acid.
| Compound Name | 3,4-dimethyl-2-prop-2-ynylhex-3-enoic acid |
|---|---|
| PubChem CID | 173326512 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3,4-dimethyl-2-prop-2-ynylhex-3-enoic acid |
| SMILES | C#CCC(C(=O)O)C(C)=C(C)CC |
| InChI | InChI=1S/C11H16O2/c1-5-7-10(11(12)13)9(4)8(3)6-2/h1,10H,6-7H2,2-4H3,(H,12,13) |
| InChIKey | ZNKRSVNHQGTWDJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|