About diazomethane;oxo(pentyl)phosphanium
diazomethane;oxo(pentyl)phosphanium (PubChem CID 173327682) has the molecular formula C6H14N2OP+
and a molecular weight of 161.16 g/mol. Its IUPAC name is diazomethane;oxo(pentyl)phosphanium.
Molecular Properties
| Compound Name | diazomethane;oxo(pentyl)phosphanium |
| PubChem CID | 173327682 |
| Molecular Formula | C6H14N2OP+ |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | diazomethane;oxo(pentyl)phosphanium |
| SMILES | C=[N+]=[N-].CCCCC[PH+]=O |
| InChI | InChI=1S/C5H11OP.CH2N2/c1-2-3-4-5-7-6;1-3-2/h2-5H2,1H3;1H2/p+1 |
| InChIKey | BZNHZALHTNURLB-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diazomethane;oxo(pentyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazomethane;oxo(pentyl)phosphanium?
The IUPAC name of diazomethane;oxo(pentyl)phosphanium (CID 173327682) is diazomethane;oxo(pentyl)phosphanium.
What is the SMILES notation for diazomethane;oxo(pentyl)phosphanium?
The canonical SMILES for diazomethane;oxo(pentyl)phosphanium is C=[N+]=[N-].CCCCC[PH+]=O.
What is the InChIKey of diazomethane;oxo(pentyl)phosphanium?
The InChIKey is BZNHZALHTNURLB-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H11OP.CH2N2/c1-2-3-4-5-7-6;1-3-2/h2-5H2,1H3;1H2/p+1.
What are the key properties of diazomethane;oxo(pentyl)phosphanium?
diazomethane;oxo(pentyl)phosphanium has a molecular weight of 161.16 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diazomethane;oxo(pentyl)phosphanium is sourced from PubChem (CID 173327682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).