C14H26BrN3O4 — CID 173328394
tert-butyl N-(3-bromopropyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 173328394) has the molecular formula C14H26BrN3O4 and a molecular weight of 380.28 g/mol. Its IUPAC name is tert-butyl N-(3-bromopropyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-(3-bromopropyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173328394 |
| Molecular Formula | C14H26BrN3O4 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | tert-butyl N-(3-bromopropyl)-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CCCBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26BrN3O4/c1-13(2,3)21-11(19)17-10(16)18(9-7-8-15)12(20)22-14(4,5)6/h7-9H2,1-6H3,(H2,16,17,19) |
| InChIKey | ZIVMWTCYDBEJON-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|