C11H15ClFO6P — CID 173329413
[(2-chloro-4-fluorophenoxy)-diethoxymethyl]phosphonic acid (PubChem CID 173329413) has the molecular formula C11H15ClFO6P and a molecular weight of 328.66 g/mol. Its IUPAC name is [(2-chloro-4-fluorophenoxy)-diethoxymethyl]phosphonic acid.
| Compound Name | [(2-chloro-4-fluorophenoxy)-diethoxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 173329413 |
| Molecular Formula | C11H15ClFO6P |
| Molecular Weight | 328.66 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | [(2-chloro-4-fluorophenoxy)-diethoxymethyl]phosphonic acid |
| SMILES | CCOC(OCC)(Oc1ccc(F)cc1Cl)P(=O)(O)O |
| InChI | InChI=1S/C11H15ClFO6P/c1-3-17-11(18-4-2,20(14,15)16)19-10-6-5-8(13)7-9(10)12/h5-7H,3-4H2,1-2H3,(H2,14,15,16) |
| InChIKey | KRJKZISEBPKZAE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|