C23H33NO5P+ — CID 173332803
4-[(1,3-benzodioxol-5-ylmethylamino)methyl]-2,6-ditert-butylphenol;hydroxy(oxo)phosphanium (PubChem CID 173332803) has the molecular formula C23H33NO5P+ and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-[(1,3-benzodioxol-5-ylmethylamino)methyl]-2,6-ditert-butylphenol;hydroxy(oxo)phosphanium.
| Compound Name | 4-[(1,3-benzodioxol-5-ylmethylamino)methyl]-2,6-ditert-butylphenol;hydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 173332803 |
| Molecular Formula | C23H33NO5P+ |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-[(1,3-benzodioxol-5-ylmethylamino)methyl]-2,6-ditert-butylphenol;hydroxy(oxo)phosphanium |
| SMILES | CC(C)(C)c1cc(CNCc2ccc3c(c2)OCO3)cc(C(C)(C)C)c1O.O=[PH+]O |
| InChI | InChI=1S/C23H31NO3.HO2P/c1-22(2,3)17-9-16(10-18(21(17)25)23(4,5)6)13-24-12-15-7-8-19-20(11-15)27-14-26-19;1-3-2/h7-11,24-25H,12-14H2,1-6H3;3H/p+1 |
| InChIKey | DISGIADAIIXZJB-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|