C13H15F5N2O — CID 173335330
1-[2-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperazine (PubChem CID 173335330) has the molecular formula C13H15F5N2O and a molecular weight of 310.27 g/mol. Its IUPAC name is 1-[2-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperazine.
| Compound Name | 1-[2-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 173335330 |
| Molecular Formula | C13H15F5N2O |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-[2-(2,2,3,3,3-pentafluoropropoxy)phenyl]piperazine |
| SMILES | FC(F)(F)C(F)(F)COc1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C13H15F5N2O/c14-12(15,13(16,17)18)9-21-11-4-2-1-3-10(11)20-7-5-19-6-8-20/h1-4,19H,5-9H2 |
| InChIKey | ZTLRUICFHXYLGU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|