C15H18N2O3 — CID 17333819
N-[2-(2,6-dioxocyclohexyl)propan-2-yl]pyridine-3-carboxamide (PubChem CID 17333819) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[2-(2,6-dioxocyclohexyl)propan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-(2,6-dioxocyclohexyl)propan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17333819 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[2-(2,6-dioxocyclohexyl)propan-2-yl]pyridine-3-carboxamide |
| SMILES | CC(C)(NC(=O)c1cccnc1)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C15H18N2O3/c1-15(2,13-11(18)6-3-7-12(13)19)17-14(20)10-5-4-8-16-9-10/h4-5,8-9,13H,3,6-7H2,1-2H3,(H,17,20) |
| InChIKey | IIBMWFXMVRBVCK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|