C13H12F3N3O2 — CID 2858266
N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]pyridine-3-carbohydrazide (PubChem CID 2858266) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 2858266 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNC1=C(C(=O)C(F)(F)F)CCC1)c1cccnc1 |
| InChI | InChI=1S/C13H12F3N3O2/c14-13(15,16)11(20)9-4-1-5-10(9)18-19-12(21)8-3-2-6-17-7-8/h2-3,6-7,18H,1,4-5H2,(H,19,21) |
| InChIKey | SGWMVWXSVVGWKZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|