C16H16N4O3 — CID 35016480
3-methyl-4-oxo-N'-(pyridine-3-carbonyl)-1,5,6,7-tetrahydroindole-2-carbohydrazide (PubChem CID 35016480) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 3-methyl-4-oxo-N'-(pyridine-3-carbonyl)-1,5,6,7-tetrahydroindole-2-carbohydrazide.
| Compound Name | 3-methyl-4-oxo-N'-(pyridine-3-carbonyl)-1,5,6,7-tetrahydroindole-2-carbohydrazide |
|---|---|
| PubChem CID | 35016480 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-methyl-4-oxo-N'-(pyridine-3-carbonyl)-1,5,6,7-tetrahydroindole-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cccnc2)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C16H16N4O3/c1-9-13-11(5-2-6-12(13)21)18-14(9)16(23)20-19-15(22)10-4-3-7-17-8-10/h3-4,7-8,18H,2,5-6H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | RYQBMDMAMRWBNB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|