C12H11F3N2O3 — CID 3147009
N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide (PubChem CID 3147009) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.22 g/mol. Its IUPAC name is N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide.
| Compound Name | N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 3147009 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNC1=C(C(=O)C(F)(F)F)CCC1)c1ccco1 |
| InChI | InChI=1S/C12H11F3N2O3/c13-12(14,15)10(18)7-3-1-4-8(7)16-17-11(19)9-5-2-6-20-9/h2,5-6,16H,1,3-4H2,(H,17,19) |
| InChIKey | CGWADPJURJXSQO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|