About methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate
methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate (PubChem CID 173339338) has the molecular formula C17H14N2O7
and a molecular weight of 358.31 g/mol. Its IUPAC name is methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate |
| PubChem CID | 173339338 |
| Molecular Formula | C17H14N2O7 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate |
| SMILES | COC(=O)COc1c(C=Cc2ccccc2)ccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N2O7/c1-25-15(20)11-26-17-13(8-7-12-5-3-2-4-6-12)9-10-14(18(21)22)16(17)19(23)24/h2-10H,11H2,1H3 |
| InChIKey | NCLMDGRZCFAHAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate?
The IUPAC name of methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate (CID 173339338) is methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate.
What is the SMILES notation for methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate?
The canonical SMILES for methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate is COC(=O)COc1c(C=Cc2ccccc2)ccc([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate?
The InChIKey is NCLMDGRZCFAHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O7/c1-25-15(20)11-26-17-13(8-7-12-5-3-2-4-6-12)9-10-14(18(21)22)16(17)19(23)24/h2-10H,11H2,1H3.
What are the key properties of methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate?
methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate has a molecular weight of 358.31 g/mol, XLogP of 3.23, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2,3-dinitro-6-(2-phenylethenyl)phenoxy]acetate is sourced from PubChem (CID 173339338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).