C15H21NO2 — CID 173339898
2-[2-[(Z)-but-2-en-2-yl]phenoxy]-N,N-dimethylpropanamide (PubChem CID 173339898) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[2-[(Z)-but-2-en-2-yl]phenoxy]-N,N-dimethylpropanamide.
| Compound Name | 2-[2-[(Z)-but-2-en-2-yl]phenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 173339898 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-[2-[(Z)-but-2-en-2-yl]phenoxy]-N,N-dimethylpropanamide |
| SMILES | C/C=C(/C)c1ccccc1OC(C)C(=O)N(C)C |
| InChI | InChI=1S/C15H21NO2/c1-6-11(2)13-9-7-8-10-14(13)18-12(3)15(17)16(4)5/h6-10,12H,1-5H3/b11-6- |
| InChIKey | MTTGVKHIHDFIRB-WDZFZDKYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |