C19H21Cl3 — CID 173340644
1-(3-methyl-1-phenylbutan-2-yl)-2-(2,2,2-trichloroethyl)benzene (PubChem CID 173340644) has the molecular formula C19H21Cl3 and a molecular weight of 355.74 g/mol. Its IUPAC name is 1-(3-methyl-1-phenylbutan-2-yl)-2-(2,2,2-trichloroethyl)benzene.
| Compound Name | 1-(3-methyl-1-phenylbutan-2-yl)-2-(2,2,2-trichloroethyl)benzene |
|---|---|
| PubChem CID | 173340644 |
| Molecular Formula | C19H21Cl3 |
| Molecular Weight | 355.74 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 1-(3-methyl-1-phenylbutan-2-yl)-2-(2,2,2-trichloroethyl)benzene |
| SMILES | CC(C)C(Cc1ccccc1)c1ccccc1CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H21Cl3/c1-14(2)18(12-15-8-4-3-5-9-15)17-11-7-6-10-16(17)13-19(20,21)22/h3-11,14,18H,12-13H2,1-2H3 |
| InChIKey | AOCAEVHSWHROGY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|