C19H33NO4Si2 — CID 173345514
methyl 1-benzyl-4-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]pyrrolidine-2-carboxylate (PubChem CID 173345514) has the molecular formula C19H33NO4Si2 and a molecular weight of 395.65 g/mol. Its IUPAC name is methyl 1-benzyl-4-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-benzyl-4-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 173345514 |
| Molecular Formula | C19H33NO4Si2 |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | methyl 1-benzyl-4-[2-methyl-1,1-bis(methylsilyloxy)propan-2-yl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(C(C)(C)C(O[SiH2]C)O[SiH2]C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H33NO4Si2/c1-19(2,18(23-25-4)24-26-5)15-11-16(17(21)22-3)20(13-15)12-14-9-7-6-8-10-14/h6-10,15-16,18H,11-13,25-26H2,1-5H3 |
| InChIKey | YAOAYZANRFTOLK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|